C20H19ClFN3O3S — CID 68679346
3-[(5-fluoro-3-naphthalen-1-ylsulfonyl-2H-indazol-7-yl)oxy]propan-1-amine;hydrochloride (PubChem CID 68679346) has the molecular formula C20H19ClFN3O3S and a molecular weight of 435.91 g/mol. Its IUPAC name is 3-[(5-fluoro-3-naphthalen-1-ylsulfonyl-2H-indazol-7-yl)oxy]propan-1-amine;hydrochloride.
| Compound Name | 3-[(5-fluoro-3-naphthalen-1-ylsulfonyl-2H-indazol-7-yl)oxy]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 68679346 |
| Molecular Formula | C20H19ClFN3O3S |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 3-[(5-fluoro-3-naphthalen-1-ylsulfonyl-2H-indazol-7-yl)oxy]propan-1-amine;hydrochloride |
| SMILES | Cl.NCCCOc1cc(F)cc2c(S(=O)(=O)c3cccc4ccccc34)[nH]nc12 |
| InChI | InChI=1S/C20H18FN3O3S.ClH/c21-14-11-16-19(17(12-14)27-10-4-9-22)23-24-20(16)28(25,26)18-8-3-6-13-5-1-2-7-15(13)18;/h1-3,5-8,11-12H,4,9-10,22H2,(H,23,24);1H |
| InChIKey | HVQPGJHSMUQLOH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|