C25H27N3O3S — CID 68679898
3-naphthalen-1-ylsulfonyl-5-(4-pyrrolidin-1-ylbutoxy)-2H-indazole (PubChem CID 68679898) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is 3-naphthalen-1-ylsulfonyl-5-(4-pyrrolidin-1-ylbutoxy)-2H-indazole.
| Compound Name | 3-naphthalen-1-ylsulfonyl-5-(4-pyrrolidin-1-ylbutoxy)-2H-indazole |
|---|---|
| PubChem CID | 68679898 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 3-naphthalen-1-ylsulfonyl-5-(4-pyrrolidin-1-ylbutoxy)-2H-indazole |
| SMILES | O=S(=O)(c1cccc2ccccc12)c1[nH]nc2ccc(OCCCCN3CCCC3)cc12 |
| InChI | InChI=1S/C25H27N3O3S/c29-32(30,24-11-7-9-19-8-1-2-10-21(19)24)25-22-18-20(12-13-23(22)26-27-25)31-17-6-5-16-28-14-3-4-15-28/h1-2,7-13,18H,3-6,14-17H2,(H,26,27) |
| InChIKey | FEPZFVMKSRZBPE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|