C26H30ClN3O3S — CID 68690371
5-(1-butylpiperidin-4-yl)oxy-3-naphthalen-1-ylsulfonyl-2H-indazole;hydrochloride (PubChem CID 68690371) has the molecular formula C26H30ClN3O3S and a molecular weight of 500.06 g/mol. Its IUPAC name is 5-(1-butylpiperidin-4-yl)oxy-3-naphthalen-1-ylsulfonyl-2H-indazole;hydrochloride.
| Compound Name | 5-(1-butylpiperidin-4-yl)oxy-3-naphthalen-1-ylsulfonyl-2H-indazole;hydrochloride |
|---|---|
| PubChem CID | 68690371 |
| Molecular Formula | C26H30ClN3O3S |
| Molecular Weight | 500.06 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 5-(1-butylpiperidin-4-yl)oxy-3-naphthalen-1-ylsulfonyl-2H-indazole;hydrochloride |
| SMILES | CCCCN1CCC(Oc2ccc3n[nH]c(S(=O)(=O)c4cccc5ccccc45)c3c2)CC1.Cl |
| InChI | InChI=1S/C26H29N3O3S.ClH/c1-2-3-15-29-16-13-20(14-17-29)32-21-11-12-24-23(18-21)26(28-27-24)33(30,31)25-10-6-8-19-7-4-5-9-22(19)25;/h4-12,18,20H,2-3,13-17H2,1H3,(H,27,28);1H |
| InChIKey | XZCFJIWZMNYMKO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.06 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |