C25H28ClN3O3S — CID 68681311
3-naphthalen-1-ylsulfonyl-5-(3-piperidin-1-ylpropoxy)-2H-indazole;hydrochloride (PubChem CID 68681311) has the molecular formula C25H28ClN3O3S and a molecular weight of 486.04 g/mol. Its IUPAC name is 3-naphthalen-1-ylsulfonyl-5-(3-piperidin-1-ylpropoxy)-2H-indazole;hydrochloride.
| Compound Name | 3-naphthalen-1-ylsulfonyl-5-(3-piperidin-1-ylpropoxy)-2H-indazole;hydrochloride |
|---|---|
| PubChem CID | 68681311 |
| Molecular Formula | C25H28ClN3O3S |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 3-naphthalen-1-ylsulfonyl-5-(3-piperidin-1-ylpropoxy)-2H-indazole;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc2ccccc12)c1[nH]nc2ccc(OCCCN3CCCCC3)cc12 |
| InChI | InChI=1S/C25H27N3O3S.ClH/c29-32(30,24-11-6-9-19-8-2-3-10-21(19)24)25-22-18-20(12-13-23(22)26-27-25)31-17-7-16-28-14-4-1-5-15-28;/h2-3,6,8-13,18H,1,4-5,7,14-17H2,(H,26,27);1H |
| InChIKey | JHLJOQNEQDSZLC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|