C23H23N3O2S — CID 143426591
3-naphthalen-1-ylsulfonyl-5-(piperidin-4-ylmethyl)-2H-indazole (PubChem CID 143426591) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-naphthalen-1-ylsulfonyl-5-(piperidin-4-ylmethyl)-2H-indazole.
| Compound Name | 3-naphthalen-1-ylsulfonyl-5-(piperidin-4-ylmethyl)-2H-indazole |
|---|---|
| PubChem CID | 143426591 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 3-naphthalen-1-ylsulfonyl-5-(piperidin-4-ylmethyl)-2H-indazole |
| SMILES | O=S(=O)(c1cccc2ccccc12)c1[nH]nc2ccc(CC3CCNCC3)cc12 |
| InChI | InChI=1S/C23H23N3O2S/c27-29(28,22-7-3-5-18-4-1-2-6-19(18)22)23-20-15-17(8-9-21(20)25-26-23)14-16-10-12-24-13-11-16/h1-9,15-16,24H,10-14H2,(H,25,26) |
| InChIKey | XQSYIKQMYPSHJL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |