C18H21ClN4O2S — CID 53320776
3-(benzenesulfonyl)-N-piperidin-4-yl-2H-indazol-5-amine;hydrochloride (PubChem CID 53320776) has the molecular formula C18H21ClN4O2S and a molecular weight of 392.91 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-piperidin-4-yl-2H-indazol-5-amine;hydrochloride.
| Compound Name | 3-(benzenesulfonyl)-N-piperidin-4-yl-2H-indazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 53320776 |
| Molecular Formula | C18H21ClN4O2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-(benzenesulfonyl)-N-piperidin-4-yl-2H-indazol-5-amine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccccc1)c1[nH]nc2ccc(NC3CCNCC3)cc12 |
| InChI | InChI=1S/C18H20N4O2S.ClH/c23-25(24,15-4-2-1-3-5-15)18-16-12-14(6-7-17(16)21-22-18)20-13-8-10-19-11-9-13;/h1-7,12-13,19-20H,8-11H2,(H,21,22);1H |
| InChIKey | LZSGBFTTXCTBNG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |