C22H23ClN4O2S — CID 53319440
3-naphthalen-1-ylsulfonyl-N-piperidin-4-yl-2H-indazol-4-amine;hydrochloride (PubChem CID 53319440) has the molecular formula C22H23ClN4O2S and a molecular weight of 442.97 g/mol. Its IUPAC name is 3-naphthalen-1-ylsulfonyl-N-piperidin-4-yl-2H-indazol-4-amine;hydrochloride.
| Compound Name | 3-naphthalen-1-ylsulfonyl-N-piperidin-4-yl-2H-indazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 53319440 |
| Molecular Formula | C22H23ClN4O2S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-naphthalen-1-ylsulfonyl-N-piperidin-4-yl-2H-indazol-4-amine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc2ccccc12)c1[nH]nc2cccc(NC3CCNCC3)c12 |
| InChI | InChI=1S/C22H22N4O2S.ClH/c27-29(28,20-10-3-6-15-5-1-2-7-17(15)20)22-21-18(8-4-9-19(21)25-26-22)24-16-11-13-23-14-12-16;/h1-10,16,23-24H,11-14H2,(H,25,26);1H |
| InChIKey | YFJNEUOVXKGKFX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |