C19H15N5O3S — CID 58812086
5-(2-azidoethoxy)-3-naphthalen-1-ylsulfonyl-2H-indazole (PubChem CID 58812086) has the molecular formula C19H15N5O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is 5-(2-azidoethoxy)-3-naphthalen-1-ylsulfonyl-2H-indazole.
| Compound Name | 5-(2-azidoethoxy)-3-naphthalen-1-ylsulfonyl-2H-indazole |
|---|---|
| PubChem CID | 58812086 |
| Molecular Formula | C19H15N5O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 5-(2-azidoethoxy)-3-naphthalen-1-ylsulfonyl-2H-indazole |
| SMILES | [N-]=[N+]=NCCOc1ccc2n[nH]c(S(=O)(=O)c3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/C19H15N5O3S/c20-24-21-10-11-27-14-8-9-17-16(12-14)19(23-22-17)28(25,26)18-7-3-5-13-4-1-2-6-15(13)18/h1-9,12H,10-11H2,(H,22,23) |
| InChIKey | CZUNDQCNEOTPJO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|