C27H25N3O3S — CID 68681547
3-(1-benzyl-3-naphthalen-1-ylsulfonylindazol-5-yl)oxypropan-1-amine (PubChem CID 68681547) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is 3-(1-benzyl-3-naphthalen-1-ylsulfonylindazol-5-yl)oxypropan-1-amine.
| Compound Name | 3-(1-benzyl-3-naphthalen-1-ylsulfonylindazol-5-yl)oxypropan-1-amine |
|---|---|
| PubChem CID | 68681547 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 3-(1-benzyl-3-naphthalen-1-ylsulfonylindazol-5-yl)oxypropan-1-amine |
| SMILES | NCCCOc1ccc2c(c1)c(S(=O)(=O)c1cccc3ccccc13)nn2Cc1ccccc1 |
| InChI | InChI=1S/C27H25N3O3S/c28-16-7-17-33-22-14-15-25-24(18-22)27(29-30(25)19-20-8-2-1-3-9-20)34(31,32)26-13-6-11-21-10-4-5-12-23(21)26/h1-6,8-15,18H,7,16-17,19,28H2 |
| InChIKey | BHUNSSNVEHGWBB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|