C10H17N — CID 153112334
3-tert-butyl-4-(2,2,2-trideuterioethyl)-2H-pyrrole (PubChem CID 153112334) has the molecular formula C10H17N and a molecular weight of 154.27 g/mol. Its IUPAC name is 3-tert-butyl-4-(2,2,2-trideuterioethyl)-2H-pyrrole.
| Compound Name | 3-tert-butyl-4-(2,2,2-trideuterioethyl)-2H-pyrrole |
|---|---|
| PubChem CID | 153112334 |
| Molecular Formula | C10H17N |
| Molecular Weight | 154.27 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-tert-butyl-4-(2,2,2-trideuterioethyl)-2H-pyrrole |
| SMILES | [2H]C([2H])([2H])CC1=C(C(C)(C)C)CN=C1 |
| InChI | InChI=1S/C10H17N/c1-5-8-6-11-7-9(8)10(2,3)4/h6H,5,7H2,1-4H3/i1D3 |
| InChIKey | VTEFOGGCZPZYSX-FIBGUPNXSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |