About 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole
3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole (PubChem CID 15314655) has the molecular formula C16H24S2
and a molecular weight of 280.50 g/mol. Its IUPAC name is 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole |
| PubChem CID | 15314655 |
| Molecular Formula | C16H24S2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole |
| SMILES | CC(C)(C)C1=CC(C2=CC=CC2)(C(C)(C)C)SS1 |
| InChI | InChI=1S/C16H24S2/c1-14(2,3)13-11-16(18-17-13,15(4,5)6)12-9-7-8-10-12/h7-9,11H,10H2,1-6H3 |
| InChIKey | RBBNLFVFWOYCLL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole?
The IUPAC name of 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole (CID 15314655) is 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole.
What is the SMILES notation for 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole?
The canonical SMILES for 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole is CC(C)(C)C1=CC(C2=CC=CC2)(C(C)(C)C)SS1.
What is the InChIKey of 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole?
The InChIKey is RBBNLFVFWOYCLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24S2/c1-14(2,3)13-11-16(18-17-13,15(4,5)6)12-9-7-8-10-12/h7-9,11H,10H2,1-6H3.
What are the key properties of 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole?
3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole has a molecular weight of 280.50 g/mol, XLogP of 5.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-3-cyclopenta-1,3-dien-1-yldithiole is sourced from PubChem (CID 15314655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).