C33H38N6O8 — CID 153150626
3-[2-ethoxycarbonyl-4-[[1-(2-methylpropyl)-4-[[4-nitro-1-(3-phenylpropyl)pyrrole-2-carbonyl]amino]pyrrole-2-carbonyl]amino]pyrrol-1-yl]propanoic acid (PubChem CID 153150626) has the molecular formula C33H38N6O8 and a molecular weight of 646.70 g/mol. Its IUPAC name is 3-[2-ethoxycarbonyl-4-[[1-(2-methylpropyl)-4-[[4-nitro-1-(3-phenylpropyl)pyrrole-2-carbonyl]amino]pyrrole-2-carbonyl]amino]pyrrol-1-yl]propanoic acid.
| Compound Name | 3-[2-ethoxycarbonyl-4-[[1-(2-methylpropyl)-4-[[4-nitro-1-(3-phenylpropyl)pyrrole-2-carbonyl]amino]pyrrole-2-carbonyl]amino]pyrrol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 153150626 |
| Molecular Formula | C33H38N6O8 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 3-[2-ethoxycarbonyl-4-[[1-(2-methylpropyl)-4-[[4-nitro-1-(3-phenylpropyl)pyrrole-2-carbonyl]amino]pyrrole-2-carbonyl]amino]pyrrol-1-yl]propanoic acid |
| SMILES | CCOC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc([N+](=O)[O-])cn3CCCc3ccccc3)cn2CC(C)C)cn1CCC(=O)O |
| InChI | InChI=1S/C33H38N6O8/c1-4-47-33(44)29-16-25(19-37(29)14-12-30(40)41)35-31(42)27-15-24(20-38(27)18-22(2)3)34-32(43)28-17-26(39(45)46)21-36(28)13-8-11-23-9-6-5-7-10-23/h5-7,9-10,15-17,19-22H,4,8,11-14,18H2,1-3H3,(H,34,43)(H,35,42)(H,40,41) |
| InChIKey | WAKDHYAZDQCWQG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 179.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|