C22H29N3O6 — CID 160585421
ethyl 2-[1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrol-2-yl]-2-oxoacetate (PubChem CID 160585421) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is ethyl 2-[1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrol-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrol-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 160585421 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl 2-[1-(2-methylpropyl)-4-[2-[1-(2-methylpropyl)-4-nitropyrrol-2-yl]-2-oxoethyl]pyrrol-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(CC(=O)c2cc([N+](=O)[O-])cn2CC(C)C)cn1CC(C)C |
| InChI | InChI=1S/C22H29N3O6/c1-6-31-22(28)21(27)19-7-16(12-23(19)10-14(2)3)8-20(26)18-9-17(25(29)30)13-24(18)11-15(4)5/h7,9,12-15H,6,8,10-11H2,1-5H3 |
| InChIKey | HKSMDYGRVBLHIP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 113.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|