C14H15N3O5 — CID 157051092
methyl 1-methyl-4-[2-(1-methyl-4-nitropyrrol-2-yl)-2-oxoethyl]pyrrole-2-carboxylate (PubChem CID 157051092) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl 1-methyl-4-[2-(1-methyl-4-nitropyrrol-2-yl)-2-oxoethyl]pyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-4-[2-(1-methyl-4-nitropyrrol-2-yl)-2-oxoethyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 157051092 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | methyl 1-methyl-4-[2-(1-methyl-4-nitropyrrol-2-yl)-2-oxoethyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(CC(=O)c2cc([N+](=O)[O-])cn2C)cn1C |
| InChI | InChI=1S/C14H15N3O5/c1-15-7-9(4-12(15)14(19)22-3)5-13(18)11-6-10(17(20)21)8-16(11)2/h4,6-8H,5H2,1-3H3 |
| InChIKey | NQDQHKRWYIEZGN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|