C12H23NO — CID 15315812
3-[(E)-but-2-en-2-yl]-2-ethyl-5,5-dimethylmorpholine (PubChem CID 15315812) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3-[(E)-but-2-en-2-yl]-2-ethyl-5,5-dimethylmorpholine.
| Compound Name | 3-[(E)-but-2-en-2-yl]-2-ethyl-5,5-dimethylmorpholine |
|---|---|
| PubChem CID | 15315812 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3-[(E)-but-2-en-2-yl]-2-ethyl-5,5-dimethylmorpholine |
| SMILES | C/C=C(\C)C1NC(C)(C)COC1CC |
| InChI | InChI=1S/C12H23NO/c1-6-9(3)11-10(7-2)14-8-12(4,5)13-11/h6,10-11,13H,7-8H2,1-5H3/b9-6+ |
| InChIKey | ZDRZGXWLDSWWFE-RMKNXTFCSA-N |
| XLogP | 2.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|