C6H12O3 — CID 15318264
(E,2S,3S)-hex-4-ene-1,2,3-triol (PubChem CID 15318264) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (E,2S,3S)-hex-4-ene-1,2,3-triol.
| Compound Name | (E,2S,3S)-hex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 15318264 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (E,2S,3S)-hex-4-ene-1,2,3-triol |
| SMILES | C/C=C/[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O3/c1-2-3-5(8)6(9)4-7/h2-3,5-9H,4H2,1H3/b3-2+/t5-,6-/m0/s1 |
| InChIKey | VRVSHOSUSHYQIQ-KXQHVCLCSA-N |
| XLogP | -0.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|