C17H15F3N6O3 — CID 153188718
N-[6-amino-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-pyridinyl]-3-(dihydroxyamino)benzamide (PubChem CID 153188718) has the molecular formula C17H15F3N6O3 and a molecular weight of 408.34 g/mol. Its IUPAC name is N-[6-amino-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-pyridinyl]-3-(dihydroxyamino)benzamide.
| Compound Name | N-[6-amino-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-pyridinyl]-3-(dihydroxyamino)benzamide |
|---|---|
| PubChem CID | 153188718 |
| Molecular Formula | C17H15F3N6O3 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[6-amino-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-pyridinyl]-3-(dihydroxyamino)benzamide |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc(NC(=O)c2cccc(N(O)O)c2)nc1N |
| InChI | InChI=1S/C17H15F3N6O3/c1-25-12(8-13(24-25)17(18,19)20)11-5-6-14(22-15(11)21)23-16(27)9-3-2-4-10(7-9)26(28)29/h2-8,28-29H,1H3,(H3,21,22,23,27) |
| InChIKey | WHPFHVHQWFQUFM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|