C22H17F3N4O — CID 164806019
N-[3-methyl-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]quinoline-7-carboxamide (PubChem CID 164806019) has the molecular formula C22H17F3N4O and a molecular weight of 410.40 g/mol. Its IUPAC name is N-[3-methyl-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]quinoline-7-carboxamide.
| Compound Name | N-[3-methyl-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 164806019 |
| Molecular Formula | C22H17F3N4O |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[3-methyl-2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenyl]quinoline-7-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2ccc3cccnc3c2)c1-c1cc(C(F)(F)F)nn1C |
| InChI | InChI=1S/C22H17F3N4O/c1-13-5-3-7-16(20(13)18-12-19(22(23,24)25)28-29(18)2)27-21(30)15-9-8-14-6-4-10-26-17(14)11-15/h3-12H,1-2H3,(H,27,30) |
| InChIKey | WLUGIEWPRXDWPR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |