C9H9N3O5S — CID 15319073
ethyl 4-methyl-1-oxido-5,7-dioxo-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-2-carboxylate (PubChem CID 15319073) has the molecular formula C9H9N3O5S and a molecular weight of 271.25 g/mol. Its IUPAC name is ethyl 4-methyl-1-oxido-5,7-dioxo-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-2-carboxylate.
| Compound Name | ethyl 4-methyl-1-oxido-5,7-dioxo-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 15319073 |
| Molecular Formula | C9H9N3O5S |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | ethyl 4-methyl-1-oxido-5,7-dioxo-[1,3]thiazolo[5,4-d]pyrimidin-1-ium-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(c(=O)[nH]c(=O)n2C)[n+]1[O-] |
| InChI | InChI=1S/C9H9N3O5S/c1-3-17-8(14)7-12(16)4-5(13)10-9(15)11(2)6(4)18-7/h3H2,1-2H3,(H,10,13,15) |
| InChIKey | NQLSKDBJGUWMAG-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|