C20H13N5O2S2 — CID 15319425
2-[(15-oxo-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-13-yl)sulfanyl]acetamide (PubChem CID 15319425) has the molecular formula C20H13N5O2S2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-[(15-oxo-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-13-yl)sulfanyl]acetamide.
| Compound Name | 2-[(15-oxo-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-13-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 15319425 |
| Molecular Formula | C20H13N5O2S2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-[(15-oxo-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-13-yl)sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nc2c(sc3nc4ccccc4nc32)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C20H13N5O2S2/c21-14(26)10-28-20-24-15-16-18(23-13-9-5-4-8-12(13)22-16)29-17(15)19(27)25(20)11-6-2-1-3-7-11/h1-9H,10H2,(H2,21,26) |
| InChIKey | LUQTZMHJCYIYRH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |