C13H9N5O3S — CID 10380971
N-[2-(formamidocarbamoyl)thieno[3,2-b]quinoxalin-3-yl]formamide (PubChem CID 10380971) has the molecular formula C13H9N5O3S and a molecular weight of 315.31 g/mol. Its IUPAC name is N-[2-(formamidocarbamoyl)thieno[3,2-b]quinoxalin-3-yl]formamide.
| Compound Name | N-[2-(formamidocarbamoyl)thieno[3,2-b]quinoxalin-3-yl]formamide |
|---|---|
| PubChem CID | 10380971 |
| Molecular Formula | C13H9N5O3S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[2-(formamidocarbamoyl)thieno[3,2-b]quinoxalin-3-yl]formamide |
| SMILES | O=CNNC(=O)c1sc2nc3ccccc3nc2c1NC=O |
| InChI | InChI=1S/C13H9N5O3S/c19-5-14-9-10-13(22-11(9)12(21)18-15-6-20)17-8-4-2-1-3-7(8)16-10/h1-6H,(H,14,19)(H,15,20)(H,18,21) |
| InChIKey | PEAODLGIGXDMIK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|