C18H10N4OS2 — CID 15319417
14-phenyl-13-sulfanylidene-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one (PubChem CID 15319417) has the molecular formula C18H10N4OS2 and a molecular weight of 362.44 g/mol. Its IUPAC name is 14-phenyl-13-sulfanylidene-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one.
| Compound Name | 14-phenyl-13-sulfanylidene-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one |
|---|---|
| PubChem CID | 15319417 |
| Molecular Formula | C18H10N4OS2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 14-phenyl-13-sulfanylidene-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one |
| SMILES | O=c1c2sc3nc4ccccc4nc3c2[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C18H10N4OS2/c23-17-15-13(21-18(24)22(17)10-6-2-1-3-7-10)14-16(25-15)20-12-9-5-4-8-11(12)19-14/h1-9H,(H,21,24) |
| InChIKey | NJPLZRYNPIZTAF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|