C18H10N4O2S — CID 15319429
14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaene-13,15-dione (PubChem CID 15319429) has the molecular formula C18H10N4O2S and a molecular weight of 346.37 g/mol. Its IUPAC name is 14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaene-13,15-dione.
| Compound Name | 14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaene-13,15-dione |
|---|---|
| PubChem CID | 15319429 |
| Molecular Formula | C18H10N4O2S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaene-13,15-dione |
| SMILES | O=c1[nH]c2c(sc3nc4ccccc4nc32)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C18H10N4O2S/c23-17-15-13(21-18(24)22(17)10-6-2-1-3-7-10)14-16(25-15)20-12-9-5-4-8-11(12)19-14/h1-9H,(H,21,24) |
| InChIKey | IQJSTOBVZNFEQP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |