C18H12N6OS — CID 15319418
13-hydrazinyl-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one (PubChem CID 15319418) has the molecular formula C18H12N6OS and a molecular weight of 360.40 g/mol. Its IUPAC name is 13-hydrazinyl-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one.
| Compound Name | 13-hydrazinyl-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one |
|---|---|
| PubChem CID | 15319418 |
| Molecular Formula | C18H12N6OS |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 13-hydrazinyl-14-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one |
| SMILES | NNc1nc2c(sc3nc4ccccc4nc32)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C18H12N6OS/c19-23-18-22-13-14-16(21-12-9-5-4-8-11(12)20-14)26-15(13)17(25)24(18)10-6-2-1-3-7-10/h1-9H,19H2,(H,22,23) |
| InChIKey | GDHFBZICUSYPKQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|