C18H26O4 — CID 153197642
(2S)-2-cyclohexyl-4-oxo-4-[(1R,2R)-2-pent-4-ynylcyclopropyl]oxybutanoic acid (PubChem CID 153197642) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-4-oxo-4-[(1R,2R)-2-pent-4-ynylcyclopropyl]oxybutanoic acid.
| Compound Name | (2S)-2-cyclohexyl-4-oxo-4-[(1R,2R)-2-pent-4-ynylcyclopropyl]oxybutanoic acid |
|---|---|
| PubChem CID | 153197642 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2S)-2-cyclohexyl-4-oxo-4-[(1R,2R)-2-pent-4-ynylcyclopropyl]oxybutanoic acid |
| SMILES | C#CCCC[C@@H]1C[C@H]1OC(=O)C[C@H](C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C18H26O4/c1-2-3-5-10-14-11-16(14)22-17(19)12-15(18(20)21)13-8-6-4-7-9-13/h1,13-16H,3-12H2,(H,20,21)/t14-,15+,16-/m1/s1 |
| InChIKey | WJHFOQQFBOEEKR-OWCLPIDISA-N |
| XLogP | 3.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|