C24H22ClFN6O2S — CID 153197807
N-[2-chloro-5-[3-(4-methylpiperazin-1-yl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 153197807) has the molecular formula C24H22ClFN6O2S and a molecular weight of 513.00 g/mol. Its IUPAC name is N-[2-chloro-5-[3-(4-methylpiperazin-1-yl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[3-(4-methylpiperazin-1-yl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 153197807 |
| Molecular Formula | C24H22ClFN6O2S |
| Molecular Weight | 513.00 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | N-[2-chloro-5-[3-(4-methylpiperazin-1-yl)quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | CN1CCN(c2cnc3ccc(-c4cnc(Cl)c(NS(=O)(=O)c5ccc(F)cc5)c4)cc3n2)CC1 |
| InChI | InChI=1S/C24H22ClFN6O2S/c1-31-8-10-32(11-9-31)23-15-27-20-7-2-16(12-21(20)29-23)17-13-22(24(25)28-14-17)30-35(33,34)19-5-3-18(26)4-6-19/h2-7,12-15,30H,8-11H2,1H3 |
| InChIKey | JZHZVMQJGRKEMI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.00 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|