About 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine
2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine (PubChem CID 153199421) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine.
Analyze 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine?
The IUPAC name of 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine (CID 153199421) is 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine.
What is the SMILES notation for 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine?
The canonical SMILES for 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine is CC1=NC2=C(C1)CN(C)CC2.
What is the InChIKey of 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine?
The InChIKey is WJPUKWYZEUYCMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7-5-8-6-11(2)4-3-9(8)10-7/h3-6H2,1-2H3.
What are the key properties of 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine?
2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine has a molecular weight of 150.22 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3,4,6,7-tetrahydropyrrolo[3,2-c]pyridine is sourced from PubChem (CID 153199421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).