C20H19N3O3S2 — CID 153217854
4-[(2R)-4-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide (PubChem CID 153217854) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-[(2R)-4-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide.
| Compound Name | 4-[(2R)-4-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 153217854 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 4-[(2R)-4-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-4-oxobutan-2-yl]-N-hydroxybenzamide |
| SMILES | C[C@H](CC(=O)c1nc(-c2nccs2)sc1C1CC1)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C20H19N3O3S2/c1-11(12-2-6-14(7-3-12)18(25)23-26)10-15(24)16-17(13-4-5-13)28-20(22-16)19-21-8-9-27-19/h2-3,6-9,11,13,26H,4-5,10H2,1H3,(H,23,25)/t11-/m1/s1 |
| InChIKey | WNBGKXYJHJUTLM-LLVKDONJSA-N |
| XLogP | 4.64 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|