C33H21F3N4O3 — CID 153221851
2-[[4-[2-[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylphenyl]-2-oxoethyl]-2-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 153221851) has the molecular formula C33H21F3N4O3 and a molecular weight of 578.55 g/mol. Its IUPAC name is 2-[[4-[2-[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylphenyl]-2-oxoethyl]-2-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[2-[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylphenyl]-2-oxoethyl]-2-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 153221851 |
| Molecular Formula | C33H21F3N4O3 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 2-[[4-[2-[3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-4-methylphenyl]-2-oxoethyl]-2-(trifluoromethyl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C(=O)Cc2ccc(CN3C(=O)c4ccccc4C3=O)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 |
| InChI | InChI=1S/C33H21F3N4O3/c1-20-8-10-23(17-22(20)12-13-25-18-37-30-7-4-14-38-40(25)30)29(41)16-21-9-11-24(28(15-21)33(34,35)36)19-39-31(42)26-5-2-3-6-27(26)32(39)43/h2-11,14-15,17-18H,16,19H2,1H3 |
| InChIKey | WNVAYUAPLBQIIX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 84.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|