C11H22NO2ScSi- — CID 153224944
hydroxy-[3-[(4-methylcyclohexanecarbonyl)amino]propyl]silanide;scandium (PubChem CID 153224944) has the molecular formula C11H22NO2ScSi- and a molecular weight of 273.34 g/mol. Its IUPAC name is hydroxy-[3-[(4-methylcyclohexanecarbonyl)amino]propyl]silanide;scandium.
| Compound Name | hydroxy-[3-[(4-methylcyclohexanecarbonyl)amino]propyl]silanide;scandium |
|---|---|
| PubChem CID | 153224944 |
| Molecular Formula | C11H22NO2ScSi- |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | hydroxy-[3-[(4-methylcyclohexanecarbonyl)amino]propyl]silanide;scandium |
| SMILES | CC1CCC(C(=O)NCCC[SiH-]O)CC1.[Sc] |
| InChI | InChI=1S/C11H22NO2Si.Sc/c1-9-3-5-10(6-4-9)11(13)12-7-2-8-15-14;/h9-10,14-15H,2-8H2,1H3,(H,12,13);/q-1; |
| InChIKey | AFJKMSDBVYUSJK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|