C13H22O3 — CID 15324223
(E)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal (PubChem CID 15324223) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (E)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal.
| Compound Name | (E)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal |
|---|---|
| PubChem CID | 15324223 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (E)-4-(1,3-dioxolan-2-yl)-4-ethyloct-2-enal |
| SMILES | CCCCC(/C=C/C=O)(CC)C1OCCO1 |
| InChI | InChI=1S/C13H22O3/c1-3-5-7-13(4-2,8-6-9-14)12-15-10-11-16-12/h6,8-9,12H,3-5,7,10-11H2,1-2H3/b8-6+ |
| InChIKey | UWPWLCWLAMARAD-SOFGYWHQSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|