C14H20O3 — CID 20719982
(2E,4E)-5-(6-methyl-1,4-dioxaspiro[4.5]decan-6-yl)penta-2,4-dienal (PubChem CID 20719982) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2E,4E)-5-(6-methyl-1,4-dioxaspiro[4.5]decan-6-yl)penta-2,4-dienal.
| Compound Name | (2E,4E)-5-(6-methyl-1,4-dioxaspiro[4.5]decan-6-yl)penta-2,4-dienal |
|---|---|
| PubChem CID | 20719982 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2E,4E)-5-(6-methyl-1,4-dioxaspiro[4.5]decan-6-yl)penta-2,4-dienal |
| SMILES | CC1(/C=C/C=C/C=O)CCCCC12OCCO2 |
| InChI | InChI=1S/C14H20O3/c1-13(7-3-2-6-10-15)8-4-5-9-14(13)16-11-12-17-14/h2-3,6-7,10H,4-5,8-9,11-12H2,1H3/b6-2+,7-3+ |
| InChIKey | PEMGVGCKBNLSBP-YPCIICBESA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|