C12H20O3 — CID 14108719
(E,6R)-7-(1,3-dioxolan-2-yl)-2,6-dimethylhept-2-enal (PubChem CID 14108719) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (E,6R)-7-(1,3-dioxolan-2-yl)-2,6-dimethylhept-2-enal.
| Compound Name | (E,6R)-7-(1,3-dioxolan-2-yl)-2,6-dimethylhept-2-enal |
|---|---|
| PubChem CID | 14108719 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (E,6R)-7-(1,3-dioxolan-2-yl)-2,6-dimethylhept-2-enal |
| SMILES | C/C(C=O)=C\CC[C@@H](C)CC1OCCO1 |
| InChI | InChI=1S/C12H20O3/c1-10(4-3-5-11(2)9-13)8-12-14-6-7-15-12/h5,9-10,12H,3-4,6-8H2,1-2H3/b11-5+/t10-/m1/s1 |
| InChIKey | PQXATIZKLFCVLX-QZULDAKNSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|