C14H12N2O — CID 15326117
1,7-dimethyl-1,10-phenanthrolin-4-one (PubChem CID 15326117) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 1,7-dimethyl-1,10-phenanthrolin-4-one.
| Compound Name | 1,7-dimethyl-1,10-phenanthrolin-4-one |
|---|---|
| PubChem CID | 15326117 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1,7-dimethyl-1,10-phenanthrolin-4-one |
| SMILES | Cc1ccnc2c1ccc1c(=O)ccn(C)c12 |
| InChI | InChI=1S/C14H12N2O/c1-9-5-7-15-13-10(9)3-4-11-12(17)6-8-16(2)14(11)13/h3-8H,1-2H3 |
| InChIKey | MDIILVRUQHKVRY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|