C10H12N2 — CID 153487597
1,4,7-trimethylpyrrolo[2,3-c]pyridine (PubChem CID 153487597) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,4,7-trimethylpyrrolo[2,3-c]pyridine.
| Compound Name | 1,4,7-trimethylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 153487597 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,4,7-trimethylpyrrolo[2,3-c]pyridine |
| SMILES | Cc1cnc(C)c2c1ccn2C |
| InChI | InChI=1S/C10H12N2/c1-7-6-11-8(2)10-9(7)4-5-12(10)3/h4-6H,1-3H3 |
| InChIKey | HBQZQXASFRJVHW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |