C19H18O4 — CID 15326393
(3aR,4S,9S,9aR)-4-hydroxy-9-methoxy-4-phenyl-1,3a,9,9a-tetrahydrobenzo[f][2]benzofuran-3-one (PubChem CID 15326393) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (3aR,4S,9S,9aR)-4-hydroxy-9-methoxy-4-phenyl-1,3a,9,9a-tetrahydrobenzo[f][2]benzofuran-3-one.
| Compound Name | (3aR,4S,9S,9aR)-4-hydroxy-9-methoxy-4-phenyl-1,3a,9,9a-tetrahydrobenzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 15326393 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (3aR,4S,9S,9aR)-4-hydroxy-9-methoxy-4-phenyl-1,3a,9,9a-tetrahydrobenzo[f][2]benzofuran-3-one |
| SMILES | CO[C@@H]1c2ccccc2[C@@](O)(c2ccccc2)[C@@H]2C(=O)OC[C@H]12 |
| InChI | InChI=1S/C19H18O4/c1-22-17-13-9-5-6-10-15(13)19(21,12-7-3-2-4-8-12)16-14(17)11-23-18(16)20/h2-10,14,16-17,21H,11H2,1H3/t14-,16-,17+,19-/m0/s1 |
| InChIKey | TUQWBYVGSSYYKM-RMRDIRSESA-N |
| XLogP | 2.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |