C19H18O2 — CID 131862528
(1S,5R)-6,6-bis(2-methylphenyl)-3-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 131862528) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1S,5R)-6,6-bis(2-methylphenyl)-3-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5R)-6,6-bis(2-methylphenyl)-3-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 131862528 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (1S,5R)-6,6-bis(2-methylphenyl)-3-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | Cc1ccccc1C1(c2ccccc2C)[C@@H]2COC(=O)[C@@H]21 |
| InChI | InChI=1S/C19H18O2/c1-12-7-3-5-9-14(12)19(15-10-6-4-8-13(15)2)16-11-21-18(20)17(16)19/h3-10,16-17H,11H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | WVNIXNPKKDHGQZ-IAGOWNOFSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |