C26H29ClF3N7 — CID 153265798
N-[3-(6-chloro-1,2-dihydropyridazin-4-yl)-7-ethylidene-3-azabicyclo[3.2.0]heptan-6-yl]-9-[3-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 153265798) has the molecular formula C26H29ClF3N7 and a molecular weight of 532.01 g/mol. Its IUPAC name is N-[3-(6-chloro-1,2-dihydropyridazin-4-yl)-7-ethylidene-3-azabicyclo[3.2.0]heptan-6-yl]-9-[3-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | N-[3-(6-chloro-1,2-dihydropyridazin-4-yl)-7-ethylidene-3-azabicyclo[3.2.0]heptan-6-yl]-9-[3-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 153265798 |
| Molecular Formula | C26H29ClF3N7 |
| Molecular Weight | 532.01 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | N-[3-(6-chloro-1,2-dihydropyridazin-4-yl)-7-ethylidene-3-azabicyclo[3.2.0]heptan-6-yl]-9-[3-(trifluoromethyl)phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | CC=C1C2CN(C3=CNNC(Cl)=C3)CC2C1Nc1nc2n(n1)CCCCC2c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H29ClF3N7/c1-2-18-20-13-36(17-11-22(27)34-31-12-17)14-21(20)23(18)32-25-33-24-19(8-3-4-9-37(24)35-25)15-6-5-7-16(10-15)26(28,29)30/h2,5-7,10-12,19-21,23,31,34H,3-4,8-9,13-14H2,1H3,(H,32,35) |
| InChIKey | WWDMWIUWVVAEPY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.01 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|