C24H26F4N6S — CID 163928798
3-amino-1-[(4R,5S)-4-[[8-[3-fluoro-5-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-7-azatricyclo[3.3.0.01,3]octan-7-yl]but-2-ene-1-thione (PubChem CID 163928798) has the molecular formula C24H26F4N6S and a molecular weight of 506.57 g/mol. Its IUPAC name is 3-amino-1-[(4R,5S)-4-[[8-[3-fluoro-5-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-7-azatricyclo[3.3.0.01,3]octan-7-yl]but-2-ene-1-thione.
| Compound Name | 3-amino-1-[(4R,5S)-4-[[8-[3-fluoro-5-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-7-azatricyclo[3.3.0.01,3]octan-7-yl]but-2-ene-1-thione |
|---|---|
| PubChem CID | 163928798 |
| Molecular Formula | C24H26F4N6S |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 3-amino-1-[(4R,5S)-4-[[8-[3-fluoro-5-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-7-azatricyclo[3.3.0.01,3]octan-7-yl]but-2-ene-1-thione |
| SMILES | CC(N)=CC(=S)N1C[C@H]2[C@H](Nc3nc4n(n3)CCCC4c3cc(F)cc(C(F)(F)F)c3)C3CC32C1 |
| InChI | InChI=1S/C24H26F4N6S/c1-12(29)5-19(35)33-10-18-20(17-9-23(17,18)11-33)30-22-31-21-16(3-2-4-34(21)32-22)13-6-14(24(26,27)28)8-15(25)7-13/h5-8,16-18,20H,2-4,9-11,29H2,1H3,(H,30,32)/t16?,17?,18-,20+,23?/m0/s1 |
| InChIKey | IZAPYBQAVXBRAV-KNEBTJFKSA-N |
| XLogP | 4.28 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|