C21H23BrN6O3 — CID 153284369
5-bromo-2-[4-[3-[6-[(Z)-dimethylaminomethylideneamino]-2-pyridinyl]-1,2,4-triazol-4-yl]butoxy]benzoic acid (PubChem CID 153284369) has the molecular formula C21H23BrN6O3 and a molecular weight of 487.36 g/mol. Its IUPAC name is 5-bromo-2-[4-[3-[6-[(Z)-dimethylaminomethylideneamino]-2-pyridinyl]-1,2,4-triazol-4-yl]butoxy]benzoic acid.
| Compound Name | 5-bromo-2-[4-[3-[6-[(Z)-dimethylaminomethylideneamino]-2-pyridinyl]-1,2,4-triazol-4-yl]butoxy]benzoic acid |
|---|---|
| PubChem CID | 153284369 |
| Molecular Formula | C21H23BrN6O3 |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 5-bromo-2-[4-[3-[6-[(Z)-dimethylaminomethylideneamino]-2-pyridinyl]-1,2,4-triazol-4-yl]butoxy]benzoic acid |
| SMILES | CN(C)/C=N\c1cccc(-c2nncn2CCCCOc2ccc(Br)cc2C(=O)O)n1 |
| InChI | InChI=1S/C21H23BrN6O3/c1-27(2)13-23-19-7-5-6-17(25-19)20-26-24-14-28(20)10-3-4-11-31-18-9-8-15(22)12-16(18)21(29)30/h5-9,12-14H,3-4,10-11H2,1-2H3,(H,29,30)/b23-13- |
| InChIKey | DILUMLXTZWALLK-QRVIBDJDSA-N |
| XLogP | 3.88 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|