C20H20F3N5O3 — CID 138458567
methyl 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-5-(trifluoromethyl)benzoate (PubChem CID 138458567) has the molecular formula C20H20F3N5O3 and a molecular weight of 435.41 g/mol. Its IUPAC name is methyl 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-5-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 138458567 |
| Molecular Formula | C20H20F3N5O3 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | methyl 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-5-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1cc(C(F)(F)F)ccc1OCCCCn1cnnc1-c1cccc(N)n1 |
| InChI | InChI=1S/C20H20F3N5O3/c1-30-19(29)14-11-13(20(21,22)23)7-8-16(14)31-10-3-2-9-28-12-25-27-18(28)15-5-4-6-17(24)26-15/h4-8,11-12H,2-3,9-10H2,1H3,(H2,24,26) |
| InChIKey | RJEQMGAGSFWCCA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|