C19H20ClN5O3 — CID 138458879
methyl 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-5-chlorobenzoate (PubChem CID 138458879) has the molecular formula C19H20ClN5O3 and a molecular weight of 401.85 g/mol. Its IUPAC name is methyl 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-5-chlorobenzoate.
| Compound Name | methyl 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-5-chlorobenzoate |
|---|---|
| PubChem CID | 138458879 |
| Molecular Formula | C19H20ClN5O3 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | methyl 2-[4-[3-(6-amino-2-pyridinyl)-1,2,4-triazol-4-yl]butoxy]-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1OCCCCn1cnnc1-c1cccc(N)n1 |
| InChI | InChI=1S/C19H20ClN5O3/c1-27-19(26)14-11-13(20)7-8-16(14)28-10-3-2-9-25-12-22-24-18(25)15-5-4-6-17(21)23-15/h4-8,11-12H,2-3,9-10H2,1H3,(H2,21,23) |
| InChIKey | ARZGEHUXSLTOBS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|