C42H25N3OPt — CID 153285546
2-[9-[4-(4-phenylphenyl)-3-pyridin-2-ylbenzene-2-id-1-yl]-1H-carbazol-1-id-2-yl]-1,3-benzoxazole;platinum(2+) (PubChem CID 153285546) has the molecular formula C42H25N3OPt and a molecular weight of 782.76 g/mol. Its IUPAC name is 2-[9-[4-(4-phenylphenyl)-3-pyridin-2-ylbenzene-2-id-1-yl]-1H-carbazol-1-id-2-yl]-1,3-benzoxazole;platinum(2+).
| Compound Name | 2-[9-[4-(4-phenylphenyl)-3-pyridin-2-ylbenzene-2-id-1-yl]-1H-carbazol-1-id-2-yl]-1,3-benzoxazole;platinum(2+) |
|---|---|
| PubChem CID | 153285546 |
| Molecular Formula | C42H25N3OPt |
| Molecular Weight | 782.76 g/mol |
| Exact Mass | 782.16 |
| IUPAC Name | 2-[9-[4-(4-phenylphenyl)-3-pyridin-2-ylbenzene-2-id-1-yl]-1H-carbazol-1-id-2-yl]-1,3-benzoxazole;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(-n2c3[c-]c(-c4nc5ccccc5o4)ccc3c3ccccc32)ccc(-c2ccc(-c3ccccc3)cc2)c1-c1ccccn1 |
| InChI | InChI=1S/C42H25N3O.Pt/c1-2-10-28(11-3-1)29-17-19-30(20-18-29)33-24-22-32(27-36(33)37-13-8-9-25-43-37)45-39-15-6-4-12-34(39)35-23-21-31(26-40(35)45)42-44-38-14-5-7-16-41(38)46-42;/h1-25H;/q-2;+2 |
| InChIKey | OSCJGTRXZOLOPX-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.76 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|