C23H24ClN3O5 — CID 153289096
[6-[1-[(4-chlorobenzoyl)amino]propyl]-3-bicyclo[3.1.0]hexanyl] N-(4-nitrophenyl)carbamate (PubChem CID 153289096) has the molecular formula C23H24ClN3O5 and a molecular weight of 457.91 g/mol. Its IUPAC name is [6-[1-[(4-chlorobenzoyl)amino]propyl]-3-bicyclo[3.1.0]hexanyl] N-(4-nitrophenyl)carbamate.
| Compound Name | [6-[1-[(4-chlorobenzoyl)amino]propyl]-3-bicyclo[3.1.0]hexanyl] N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 153289096 |
| Molecular Formula | C23H24ClN3O5 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | [6-[1-[(4-chlorobenzoyl)amino]propyl]-3-bicyclo[3.1.0]hexanyl] N-(4-nitrophenyl)carbamate |
| SMILES | CCC(NC(=O)c1ccc(Cl)cc1)C1C2CC(OC(=O)Nc3ccc([N+](=O)[O-])cc3)CC21 |
| InChI | InChI=1S/C23H24ClN3O5/c1-2-20(26-22(28)13-3-5-14(24)6-4-13)21-18-11-17(12-19(18)21)32-23(29)25-15-7-9-16(10-8-15)27(30)31/h3-10,17-21H,2,11-12H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | BLCNHDPDWDBJOO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|