C21H22ClFN4O3 — CID 153288968
4-chloro-N-[1-[(1S,5R)-3-[(5-fluoro-3-nitro-2-pyridinyl)amino]-6-bicyclo[3.1.0]hexanyl]propyl]benzamide (PubChem CID 153288968) has the molecular formula C21H22ClFN4O3 and a molecular weight of 432.88 g/mol. Its IUPAC name is 4-chloro-N-[1-[(1S,5R)-3-[(5-fluoro-3-nitro-2-pyridinyl)amino]-6-bicyclo[3.1.0]hexanyl]propyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(1S,5R)-3-[(5-fluoro-3-nitro-2-pyridinyl)amino]-6-bicyclo[3.1.0]hexanyl]propyl]benzamide |
|---|---|
| PubChem CID | 153288968 |
| Molecular Formula | C21H22ClFN4O3 |
| Molecular Weight | 432.88 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-chloro-N-[1-[(1S,5R)-3-[(5-fluoro-3-nitro-2-pyridinyl)amino]-6-bicyclo[3.1.0]hexanyl]propyl]benzamide |
| SMILES | CCC(NC(=O)c1ccc(Cl)cc1)C1[C@H]2CC(Nc3ncc(F)cc3[N+](=O)[O-])C[C@@H]12 |
| InChI | InChI=1S/C21H22ClFN4O3/c1-2-17(26-21(28)11-3-5-12(22)6-4-11)19-15-8-14(9-16(15)19)25-20-18(27(29)30)7-13(23)10-24-20/h3-7,10,14-17,19H,2,8-9H2,1H3,(H,24,25)(H,26,28)/t14?,15-,16+,17?,19? |
| InChIKey | ZUDQECXVOZURKJ-PVOWQQPYSA-N |
| XLogP | 4.43 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|