C21H23ClN4O2 — CID 162478507
N-[6-[1-[(4-chlorobenzoyl)amino]propyl]-3-bicyclo[3.1.0]hexanyl]pyrimidine-4-carboxamide (PubChem CID 162478507) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[6-[1-[(4-chlorobenzoyl)amino]propyl]-3-bicyclo[3.1.0]hexanyl]pyrimidine-4-carboxamide.
| Compound Name | N-[6-[1-[(4-chlorobenzoyl)amino]propyl]-3-bicyclo[3.1.0]hexanyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 162478507 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[6-[1-[(4-chlorobenzoyl)amino]propyl]-3-bicyclo[3.1.0]hexanyl]pyrimidine-4-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(Cl)cc1)C1C2CC(NC(=O)c3ccncn3)CC21 |
| InChI | InChI=1S/C21H23ClN4O2/c1-2-17(26-20(27)12-3-5-13(22)6-4-12)19-15-9-14(10-16(15)19)25-21(28)18-7-8-23-11-24-18/h3-8,11,14-17,19H,2,9-10H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | APYXXLGWTBSTMM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |