C22H23ClFN3O3 — CID 149471257
4-chloro-N-[1-[(1R,5S)-3-(5-fluoro-2-nitroanilino)-6-bicyclo[3.1.0]hexanyl]propyl]benzamide (PubChem CID 149471257) has the molecular formula C22H23ClFN3O3 and a molecular weight of 431.90 g/mol. Its IUPAC name is 4-chloro-N-[1-[(1R,5S)-3-(5-fluoro-2-nitroanilino)-6-bicyclo[3.1.0]hexanyl]propyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(1R,5S)-3-(5-fluoro-2-nitroanilino)-6-bicyclo[3.1.0]hexanyl]propyl]benzamide |
|---|---|
| PubChem CID | 149471257 |
| Molecular Formula | C22H23ClFN3O3 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-chloro-N-[1-[(1R,5S)-3-(5-fluoro-2-nitroanilino)-6-bicyclo[3.1.0]hexanyl]propyl]benzamide |
| SMILES | CCC(NC(=O)c1ccc(Cl)cc1)C1[C@H]2CC(Nc3cc(F)ccc3[N+](=O)[O-])C[C@@H]12 |
| InChI | InChI=1S/C22H23ClFN3O3/c1-2-18(26-22(28)12-3-5-13(23)6-4-12)21-16-10-15(11-17(16)21)25-19-9-14(24)7-8-20(19)27(29)30/h3-9,15-18,21,25H,2,10-11H2,1H3,(H,26,28)/t15?,16-,17+,18?,21? |
| InChIKey | ZBKDCJOKNHZFPM-WHWMZARZSA-N |
| XLogP | 5.03 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|