C35H45FN6O4 — CID 153290486
[2-[[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]pyrimidin-4-yl]oxymethyl nonyl carbonate (PubChem CID 153290486) has the molecular formula C35H45FN6O4 and a molecular weight of 632.78 g/mol. Its IUPAC name is [2-[[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]pyrimidin-4-yl]oxymethyl nonyl carbonate.
| Compound Name | [2-[[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]pyrimidin-4-yl]oxymethyl nonyl carbonate |
|---|---|
| PubChem CID | 153290486 |
| Molecular Formula | C35H45FN6O4 |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | [2-[[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]pyrimidin-4-yl]oxymethyl nonyl carbonate |
| SMILES | CCCCCCCCCOC(=O)OCOc1ccnc(N(C)C2CCN(c3nc4ccccc4n3Cc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C35H45FN6O4/c1-3-4-5-6-7-8-11-24-44-35(43)46-26-45-32-18-21-37-33(39-32)40(2)29-19-22-41(23-20-29)34-38-30-12-9-10-13-31(30)42(34)25-27-14-16-28(36)17-15-27/h9-10,12-18,21,29H,3-8,11,19-20,22-26H2,1-2H3 |
| InChIKey | HWLKYDZFUFPCRI-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|