C37H50FN7O3 — CID 58096469
[2-[[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]pyrimidin-4-yl]oxymethyl N-ethyl-N-nonylcarbamate (PubChem CID 58096469) has the molecular formula C37H50FN7O3 and a molecular weight of 659.85 g/mol. Its IUPAC name is [2-[[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]pyrimidin-4-yl]oxymethyl N-ethyl-N-nonylcarbamate.
| Compound Name | [2-[[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]pyrimidin-4-yl]oxymethyl N-ethyl-N-nonylcarbamate |
|---|---|
| PubChem CID | 58096469 |
| Molecular Formula | C37H50FN7O3 |
| Molecular Weight | 659.85 g/mol |
| Exact Mass | 659.40 |
| IUPAC Name | [2-[[1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]pyrimidin-4-yl]oxymethyl N-ethyl-N-nonylcarbamate |
| SMILES | CCCCCCCCCN(CC)C(=O)OCOc1ccnc(N(C)C2CCN(c3nc4ccccc4n3Cc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C37H50FN7O3/c1-4-6-7-8-9-10-13-24-43(5-2)37(46)48-28-47-34-20-23-39-35(41-34)42(3)31-21-25-44(26-22-31)36-40-32-14-11-12-15-33(32)45(36)27-29-16-18-30(38)19-17-29/h11-12,14-20,23,31H,4-10,13,21-22,24-28H2,1-3H3 |
| InChIKey | AXBKDRSWXHSBJC-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 88.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.85 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|