C25H30N4O4 — CID 153291605
4-acetamido-N-[2-methyl-2-(8-nitro-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl)propyl]benzamide (PubChem CID 153291605) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-acetamido-N-[2-methyl-2-(8-nitro-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl)propyl]benzamide.
| Compound Name | 4-acetamido-N-[2-methyl-2-(8-nitro-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 153291605 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 4-acetamido-N-[2-methyl-2-(8-nitro-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinolin-4-yl)propyl]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NCC(C)(C)C2Nc3ccc([N+](=O)[O-])cc3C3CCCC32)cc1 |
| InChI | InChI=1S/C25H30N4O4/c1-15(30)27-17-9-7-16(8-10-17)24(31)26-14-25(2,3)23-20-6-4-5-19(20)21-13-18(29(32)33)11-12-22(21)28-23/h7-13,19-20,23,28H,4-6,14H2,1-3H3,(H,26,31)(H,27,30) |
| InChIKey | IHGUWQVWKYVORI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|